ChemNet > CAS > 659-30-3 4-fluorophenylurea
659-30-3 4-fluorophenylurea
| produktnavn |
4-fluorophenylurea |
| Engelsk navn |
4-fluorophenylurea;Urea, 1-(p-fluorophenyl)-; (4-Fluorophenyl)urea; 1-(p-Fluorophenyl)urea; 4-12-00-01108 (Beilstein Handbook Reference); BRN 2090131; 1-(4-fluorophenyl)urea; 1-(4-fluorophenyl)-1H-pyrrole |
| Molekylær Formel |
C10H8FN |
| Molekylvekt |
161.1756 |
| InChI |
InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
| CAS-nummer |
659-30-3 |
| Molecular Structure |
|
| Tetthet |
1.07g/cm3 |
| Kokepunkt |
229.7°C at 760 mmHg |
| Brytningsindeks |
1.543 |
| Flammepunktet |
92.7°C |
| Damptrykk |
0.104mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
