ChemNet > CAS > 6590-97-2 2,3-Dichloroisothiocyanatobenzene
6590-97-2 2,3-Dichloroisothiocyanatobenzene
produktnavn |
2,3-Dichloroisothiocyanatobenzene |
Engelsk navn |
2,3-Dichloroisothiocyanatobenzene; |
Molekylær Formel |
C7H3Cl2NS |
Molekylvekt |
204.0764 |
InChI |
InChI=1/C7H3Cl2NS/c8-5-2-1-3-6(7(5)9)10-4-11/h1-3H |
CAS-nummer |
6590-97-2 |
Molecular Structure |
|
Tetthet |
1.37g/cm3 |
Kokepunkt |
311.3°C at 760 mmHg |
Brytningsindeks |
1.614 |
Flammepunktet |
142.1°C |
Damptrykk |
0.00104mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|