67487-35-8 2,5-Dichlorobenzhydrazide

produktnavn	2,5-Dichlorobenzhydrazide
Engelsk navn	2,5-Dichlorobenzhydrazide; 2,5-Dichlorobenzoic acid hydrazide; 2,5-dichlorobenzohydrazide
Molekylær Formel	C₇H₆Cl₂N₂O
Molekylvekt	205.0413
InChI	InChI=1/C7H6Cl2N2O/c8-4-1-2-6(9)5(3-4)7(12)11-10/h1-3H,10H2,(H,11,12)
CAS-nummer	67487-35-8
Molecular Structure
Tetthet	1.455g/cm³
Smeltepunkt	180-181℃
Brytningsindeks	1.605
Hazard symboler
Risiko Koder	R36/37/38:Irritating to eyes, respiratory system and skin.;
Sikkerhet Beskrivelse	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;