ChemNet > CAS > 68412-01-1 d-glucitol, reaksjonsprodukter med epiklorhydrin
68412-01-1 d-glucitol, reaksjonsprodukter med epiklorhydrin
| produktnavn |
d-glucitol, reaksjonsprodukter med epiklorhydrin |
| Synonymer |
D-glucitol, reaksjonsprodukter med epiklorhydrin; Sorbitol, diett med metyloksiran; 2- (klormetyl)oksiran - D-glucitol (1:1) |
| Engelsk navn |
d-Glucitol, reaction products with epichlorohydrin;D-Glucitol, reaction products with epichlorohydrin; Sorbitol, diether with methyloxirane; 2-(chloromethyl)oxirane - D-glucitol (1:1) |
| Molekylær Formel |
C9H19ClO7 |
| Molekylvekt |
274.696 |
| InChI |
InChI=1/C6H14O6.C3H5ClO/c7-1-3(9)5(11)6(12)4(10)2-8;4-1-3-2-5-3/h3-12H,1-2H2;3H,1-2H2/t3-,4+,5-,6-;/m1./s1 |
| CAS-nummer |
68412-01-1 |
| EINECS |
270-160-6 |
| Molecular Structure |
|
| Kokepunkt |
494.9°C at 760 mmHg |
| Flammepunktet |
292.5°C |
| Damptrykk |
7.22E-12mmHg at 25°C |
|