ChemNet > CAS > 6950-92-1 2,4,6-Trimethylphenethylalcohol
6950-92-1 2,4,6-Trimethylphenethylalcohol
produktnavn |
2,4,6-Trimethylphenethylalcohol |
Engelsk navn |
2,4,6-Trimethylphenethylalcohol; 2-Mesitylethanol; 2-Hydroxyethylmesitylene~2,4,6-Trimethylphenethyl alcohol~2-(2,4,6-Trimethylphenyl)ethanol; 2-(2,4,6-trimethylphenyl)ethanol |
Molekylær Formel |
C11H16O |
Molekylvekt |
164.2441 |
InChI |
InChI=1/C11H16O/c1-8-6-9(2)11(4-5-12)10(3)7-8/h6-7,12H,4-5H2,1-3H3 |
CAS-nummer |
6950-92-1 |
EINECS |
230-123-7 |
Molecular Structure |
|
Tetthet |
0.974g/cm3 |
Kokepunkt |
290.7°C at 760 mmHg |
Brytningsindeks |
1.526 |
Flammepunktet |
138.4°C |
Damptrykk |
0.000939mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|