ChemNet > CAS > 69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
| produktnavn |
Ethyl 5-nitrobenzofuran-2-carboxylate |
| Engelsk navn |
Ethyl 5-nitrobenzofuran-2-carboxylate; 5-Nitrobenzo[b]furan-2-carboxylic acid ethyl ester; 5-nitro-benzofuran-2-carboxylic acid ethyl ester; Vilazodone Intermediate 7; Ethyl 5-nitrobenzo[b]furan-2-carboxylate |
| Molekylær Formel |
C11H9NO5 |
| Molekylvekt |
235.1929 |
| InChI |
InChI=1/C11H9NO5/c1-2-16-11(13)10-6-7-5-8(12(14)15)3-4-9(7)17-10/h3-6H,2H2,1H3 |
| CAS-nummer |
69604-00-8 |
| Molecular Structure |
|
| Tetthet |
1.362g/cm3 |
| Smeltepunkt |
150℃ |
| Kokepunkt |
359.7°C at 760 mmHg |
| Brytningsindeks |
1.603 |
| Flammepunktet |
171.3°C |
| Damptrykk |
2.34E-05mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
