6973-77-9 N-(1-naftyl)maleamsyre
produktnavn |
N-(1-naftyl)maleamsyre |
Synonymer |
; N-(1-naftyl)maleaminsyre; (2Z)-4-(naftalen-1-ylamino)-4-oksobut-2-ensyre |
Engelsk navn |
N-(1-Naphthyl)maleamic acid; N-(1-Naphthyl)maleamic acid; (2Z)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid |
Molekylær Formel |
C14H11NO3 |
Molekylvekt |
241.242 |
InChI |
InChI=1/C14H11NO3/c16-13(8-9-14(17)18)15-12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,(H,15,16)(H,17,18)/b9-8- |
CAS-nummer |
6973-77-9 |
Molecular Structure |
|
Tetthet |
1.356g/cm3 |
Kokepunkt |
533.9°C at 760 mmHg |
Brytningsindeks |
1.706 |
Flammepunktet |
276.7°C |
Damptrykk |
3.15E-12mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|