ChemNet > CAS > 71022-43-0 3,5-Dinitrobenzyl alcohol
71022-43-0 3,5-Dinitrobenzyl alcohol
produktnavn |
3,5-Dinitrobenzyl alcohol |
Engelsk navn |
3,5-Dinitrobenzyl alcohol; (3,5-dinitrophenyl)methanol |
Molekylær Formel |
C7H6N2O5 |
Molekylvekt |
198.1329 |
InChI |
InChI=1/C7H6N2O5/c10-4-5-1-6(8(11)12)3-7(2-5)9(13)14/h1-3,10H,4H2 |
CAS-nummer |
71022-43-0 |
EINECS |
275-131-1 |
Molecular Structure |
|
Tetthet |
1.56g/cm3 |
Smeltepunkt |
88-92℃ |
Kokepunkt |
404.2°C at 760 mmHg |
Brytningsindeks |
1.641 |
Flammepunktet |
183.7°C |
Damptrykk |
2.94E-07mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|