ChemNet > CAS > 71083-06-2 Etyl 1,4-dihydro-8-fluor-4-oksokinolin-3-karboksylat
71083-06-2 Etyl 1,4-dihydro-8-fluor-4-oksokinolin-3-karboksylat
| produktnavn |
Etyl 1,4-dihydro-8-fluor-4-oksokinolin-3-karboksylat |
| Synonymer |
; Etyl 8-fluor-4-hydroksykinolin-3-; Etyl 8-fluor-4-okso-1,4-dihydrokinolin-3-karboksylat; [klor(fluor)metyl]benzen |
| Engelsk navn |
Ethyl 1,4-dihydro-8-fluoro-4-oxoquinoline-3-carboxylate; Ethyl 8-fluoro-4-hydroxyquinoline-3-; Ethyl 8-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate; [chloro(fluoro)methyl]benzene |
| Molekylær Formel |
C7H6ClF |
| Molekylvekt |
144.5739 |
| InChI |
InChI=1/C7H6ClF/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| CAS-nummer |
71083-06-2 |
| Molecular Structure |
|
| Tetthet |
1.172g/cm3 |
| Smeltepunkt |
217-219℃ |
| Kokepunkt |
166.1°C at 760 mmHg |
| Brytningsindeks |
1.498 |
| Flammepunktet |
53.7°C |
| Damptrykk |
2.38mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
