711-79-5 2-Acetyl-1-naphthol
produktnavn |
2-Acetyl-1-naphthol |
Engelsk navn |
2-Acetyl-1-naphthol; 1-Hydroxy-2-acetonaphthone; 2-Acetyl-1-hydroxynaphthalene |
Molekylær Formel |
C12H10O2 |
Molekylvekt |
186.2066 |
InChI |
InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
CAS-nummer |
711-79-5 |
EINECS |
211-918-8 |
Molecular Structure |
|
Tetthet |
1.213g/cm3 |
Smeltepunkt |
97-100℃ |
Kokepunkt |
334.9°C at 760 mmHg |
Brytningsindeks |
1.65 |
Flammepunktet |
142.4°C |
Damptrykk |
6.37E-05mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|