71902-33-5 3,5-Difluoropyridine
produktnavn |
3,5-Difluoropyridine |
Engelsk navn |
3,5-Difluoropyridine; |
Molekylær Formel |
C5H3F2N |
Molekylvekt |
115.0808 |
InChI |
InChI=1/C5H3F2N/c6-4-1-5(7)3-8-2-4/h1-3H |
CAS-nummer |
71902-33-5 |
Molecular Structure |
|
Tetthet |
1.263g/cm3 |
Kokepunkt |
79.4°C at 760 mmHg |
Brytningsindeks |
1.446 |
Flammepunktet |
1.9°C |
Damptrykk |
98.5mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|