ChemNet > CAS > 7197-96-8 2,3-cycloheptenopyridine
7197-96-8 2,3-cycloheptenopyridine
| produktnavn |
2,3-cycloheptenopyridine |
| Engelsk navn |
2,3-cycloheptenopyridine; |
| Molekylær Formel |
C10H13N |
| Molekylvekt |
147.2169 |
| InChI |
InChI=1/C10H13N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h4,6,8H,1-3,5,7H2 |
| CAS-nummer |
7197-96-8 |
| EINECS |
230-568-7 |
| Molecular Structure |
|
| Tetthet |
0.999g/cm3 |
| Kokepunkt |
224.9°C at 760 mmHg |
| Brytningsindeks |
1.533 |
| Flammepunktet |
93.3°C |
| Damptrykk |
0.133mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
