720-44-5 4-Methoxybenzhydrol
produktnavn |
4-Methoxybenzhydrol |
Engelsk navn |
4-Methoxybenzhydrol; 4-Methoxydiphenylmethanol~4-Methoxyphenyl phenyl carbinol; (4-methoxyphenyl)(phenyl)methanol |
Molekylær Formel |
C14H14O2 |
Molekylvekt |
214.2598 |
InChI |
InChI=1/C14H14O2/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-10,14-15H,1H3 |
CAS-nummer |
720-44-5 |
EINECS |
211-953-9 |
Molecular Structure |
|
Tetthet |
1.121g/cm3 |
Kokepunkt |
363.2°C at 760 mmHg |
Brytningsindeks |
1.582 |
Flammepunktet |
164.5°C |
Damptrykk |
6.55E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|