ChemNet > CAS > 7209-11-2 1-(4-Bromo-2-thienyl)ethan-1-one
7209-11-2 1-(4-Bromo-2-thienyl)ethan-1-one
produktnavn |
1-(4-Bromo-2-thienyl)ethan-1-one |
Engelsk navn |
1-(4-Bromo-2-thienyl)ethan-1-one; 1-(4-bromothiophen-2-yl)ethanone; 4-bromo-2-acetylthiophene |
Molekylær Formel |
C6H5BrOS |
Molekylvekt |
205.0723 |
InChI |
InChI=1/C6H5BrOS/c1-4(8)6-2-5(7)3-9-6/h2-3H,1H3 |
CAS-nummer |
7209-11-2 |
Molecular Structure |
|
Tetthet |
1.619g/cm3 |
Kokepunkt |
284.4°C at 760 mmHg |
Brytningsindeks |
1.583 |
Flammepunktet |
125.8°C |
Damptrykk |
0.00299mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|