ChemNet > CAS > 72235-55-3 3-Chloro-2-fluorobenzylamine
72235-55-3 3-Chloro-2-fluorobenzylamine
| produktnavn |
3-Chloro-2-fluorobenzylamine |
| Engelsk navn |
3-Chloro-2-fluorobenzylamine; 1-(3-chloro-2-fluorophenyl)methanamine |
| Molekylær Formel |
C7H7ClFN |
| Molekylvekt |
159.5886 |
| InChI |
InChI=1/C7H7ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
| CAS-nummer |
72235-55-3 |
| Molecular Structure |
|
| Tetthet |
1.27g/cm3 |
| Kokepunkt |
219.6°C at 760 mmHg |
| Brytningsindeks |
1.543 |
| Flammepunktet |
86.6°C |
| Damptrykk |
0.119mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
