728-87-0 4,4'-Dimethoxybenzhydrol
produktnavn |
4,4'-Dimethoxybenzhydrol |
Engelsk navn |
4,4'-Dimethoxybenzhydrol; Bis(4-methoxyphenyl) carbinol; 4,4-Dimethoxydiphenylmethanol; 4,4-Dimethoxybenzhydrol; Bis(4-methoxyphenyl)carbinol; bis(4-methoxyphenyl)methanol |
Molekylær Formel |
C15H16O3 |
Molekylvekt |
244.2857 |
InChI |
InChI=1/C15H16O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15-16H,1-2H3 |
CAS-nummer |
728-87-0 |
EINECS |
211-975-9 |
Molecular Structure |
|
Tetthet |
1.135g/cm3 |
Smeltepunkt |
68-72℃ |
Kokepunkt |
406.5°C at 760 mmHg |
Brytningsindeks |
1.568 |
Flammepunktet |
199.6°C |
Damptrykk |
2.46E-07mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|