ChemNet > CAS > 7355-22-8 5-Bromo-§
7355-22-8 5-Bromo-§
| produktnavn |
5-Bromo-§ |
| Engelsk navn |
5-Bromo-§ 5-Bromo-2,4-dihydroxybenzoic acid monohydrate; 5-bromo-2,4-dihydroxybenzoic acid |
| Molekylær Formel |
C7H5BrO4 |
| Molekylvekt |
233.0162 |
| InChI |
InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
| CAS-nummer |
7355-22-8 |
| EINECS |
230-881-9 |
| Molecular Structure |
|
| Tetthet |
2.026g/cm3 |
| Kokepunkt |
436.7°C at 760 mmHg |
| Brytningsindeks |
1.703 |
| Flammepunktet |
217.9°C |
| Damptrykk |
2.13E-08mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
