ChemNet > CAS > 7423-93-0 3-Chloro-L-tyrosine
7423-93-0 3-Chloro-L-tyrosine
| produktnavn |
3-Chloro-L-tyrosine |
| Engelsk navn |
3-Chloro-L-tyrosine; 3-Chloro-4-hydroxy-L-phenylalanine~H-Tyr(3-Cl)-OH; 3-chlorotyrosine; H-Tyr(3-Cl)-OH |
| Molekylær Formel |
C9H10ClNO3 |
| Molekylvekt |
215.6336 |
| InChI |
InChI=1/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
| CAS-nummer |
7423-93-0 |
| EINECS |
231-050-3 |
| Molecular Structure |
|
| Tetthet |
1.458g/cm3 |
| Smeltepunkt |
249℃ |
| Kokepunkt |
388.6°C at 760 mmHg |
| Brytningsindeks |
1.625 |
| Flammepunktet |
188.8°C |
| Damptrykk |
9.81E-07mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
