ChemNet > CAS > 74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
produktnavn |
1,3-Thiazolin-4-one-2-acetonitrile |
Engelsk navn |
1,3-Thiazolin-4-one-2-acetonitrile; 2-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile; (4-oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile |
Molekylær Formel |
C5H4N2OS |
Molekylvekt |
140.1631 |
InChI |
InChI=1/C5H4N2OS/c6-2-1-5-7-4(8)3-9-5/h1,3H2 |
CAS-nummer |
74246-64-3 |
Molecular Structure |
|
Tetthet |
1.43g/cm3 |
Smeltepunkt |
185℃ |
Kokepunkt |
300.6°C at 760 mmHg |
Brytningsindeks |
1.675 |
Flammepunktet |
135.6°C |
Damptrykk |
0.00111mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|