ChemNet > CAS > 7499-07-2 4-Chloro-2-methylbenzoic acid
7499-07-2 4-Chloro-2-methylbenzoic acid
produktnavn |
4-Chloro-2-methylbenzoic acid |
Engelsk navn |
4-Chloro-2-methylbenzoic acid; |
Molekylær Formel |
C8H7ClO2 |
Molekylvekt |
170.593 |
InChI |
InChI=1/C8H7ClO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
CAS-nummer |
7499-07-2 |
Molecular Structure |
|
Tetthet |
1.31g/cm3 |
Smeltepunkt |
180℃ |
Kokepunkt |
300.3°C at 760 mmHg |
Brytningsindeks |
1.573 |
Flammepunktet |
135.4°C |
Damptrykk |
0.000504mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|