ChemNet > CAS > 7549-37-3 citral dimethyl acetal, mixture of cis and T
7549-37-3 citral dimethyl acetal, mixture of cis and T
| produktnavn |
citral dimethyl acetal, mixture of cis and T |
| Engelsk navn |
citral dimethyl acetal, mixture of cis and T; Citral dimethyl acetal; 1,1-Dimethoxy-3,7-Dimethyl-2,6-Octadiene; 1,1-dimethoxy-3,7-dimethylocta-2,6-diene; (2E)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene; (2Z)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene |
| Molekylær Formel |
C12H22O2 |
| Molekylvekt |
198.3019 |
| InChI |
InChI=1/C12H22O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h7,9,12H,6,8H2,1-5H3/b11-9- |
| CAS-nummer |
7549-37-3 |
| EINECS |
231-434-0 |
| Molecular Structure |
|
| Tetthet |
0.875g/cm3 |
| Kokepunkt |
237.7°C at 760 mmHg |
| Brytningsindeks |
1.45 |
| Flammepunktet |
82.2°C |
| Damptrykk |
0.0678mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R43:;
|
| Sikkerhet Beskrivelse |
S36/37:;
|
|
