ChemNet > CAS > 7685-44-1 DL-2-Amino-4-pentenoic acid
7685-44-1;1069-48-3 DL-2-Amino-4-pentenoic acid
produktnavn |
DL-2-Amino-4-pentenoic acid |
Engelsk navn |
DL-2-Amino-4-pentenoic acid; DL-Allylglycine 2-Amino-4-pentenoic acid; DL-2-aminopent-4-enoic acid; 2-aminopent-4-enoic acid; N-prop-2-en-1-ylglycine |
Molekylær Formel |
C5H9NO2 |
Molekylvekt |
115.1305 |
InChI |
InChI=1/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8)/t4-/m1/s1 |
CAS-nummer |
7685-44-1;1069-48-3 |
EINECS |
231-689-8 |
Molecular Structure |
|
Tetthet |
1.098g/cm3 |
Smeltepunkt |
251-253℃ |
Kokepunkt |
231°C at 760 mmHg |
Brytningsindeks |
1.484 |
Flammepunktet |
93.5°C |
Damptrykk |
0.0226mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:;
S24/25:Avoid contact with skin and eyes.;
|
|