ChemNet > CAS > 77-61-2 2,4-dimetyl-6-(1-metylcykloheksyl)fenol
77-61-2 2,4-dimetyl-6-(1-metylcykloheksyl)fenol
| produktnavn |
2,4-dimetyl-6-(1-metylcykloheksyl)fenol |
| Synonymer |
; Lowinox (rg WSL; 6-(1-metylcykloheksyl)-2,4-xylenol |
| Engelsk navn |
2,4-Dimethyl-6-(1-methylcyclohexyl)phenol; Lowinox(rg WSL; 6-(1-Methylcyclohexyl)-2,4-xylenol |
| Molekylær Formel |
C15H22O |
| Molekylvekt |
218.3346 |
| InChI |
InChI=1/C15H22O/c1-11-9-12(2)14(16)13(10-11)15(3)7-5-4-6-8-15/h9-10,16H,4-8H2,1-3H3 |
| CAS-nummer |
77-61-2 |
| EINECS |
201-042-4 |
| Molecular Structure |
|
| Tetthet |
0.992g/cm3 |
| Kokepunkt |
311°C at 760 mmHg |
| Brytningsindeks |
1.532 |
| Flammepunktet |
140°C |
| Damptrykk |
0.000317mmHg at 25°C |
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|