771-62-0 pentafluorothiophenol
produktnavn |
pentafluorothiophenol |
Engelsk navn |
pentafluorothiophenol; Pentafluorobenzenethiol |
Molekylær Formel |
C6HF5S |
Molekylvekt |
200.12 |
InChI |
InChI=1/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
CAS-nummer |
771-62-0 |
EINECS |
212-236-3 |
Molecular Structure |
|
Tetthet |
1.5 |
Smeltepunkt |
-24℃ |
Kokepunkt |
143℃ |
Brytningsindeks |
1.463-1.465 |
Flammepunktet |
51℃ |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R10:Flammable.;
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|