ChemNet > CAS > 77538-19-3 Docosanoic acid, ester with 1,2,3-propanetriol
77538-19-3 Docosanoic acid, ester with 1,2,3-propanetriol
produktnavn |
Docosanoic acid, ester with 1,2,3-propanetriol |
Engelsk navn |
Docosanoic acid, ester with 1,2,3-propanetriol; 1,2,3-Propanetriol docosanoate; Behenin; 2,3-dihydroxypropyl docosanoate |
Molekylær Formel |
C25H50O4 |
Molekylvekt |
414.6621 |
InChI |
InChI=1/C25H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)29-23-24(27)22-26/h24,26-27H,2-23H2,1H3 |
CAS-nummer |
77538-19-3 |
EINECS |
278-717-5 |
Molecular Structure |
|
Tetthet |
0.942g/cm3 |
Kokepunkt |
525.8°C at 760 mmHg |
Brytningsindeks |
1.469 |
Flammepunktet |
161.3°C |
Damptrykk |
2.97E-13mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
|
|