ChemNet > CAS > 82374-34-3 Bis-(2-ethylhexyl)-sulfoxide
82374-34-3 Bis-(2-ethylhexyl)-sulfoxide
| produktnavn |
Bis-(2-ethylhexyl)-sulfoxide |
| Engelsk navn |
Bis-(2-ethylhexyl)-sulfoxide; Bis(2-ethylhexyl)sulfoxide; Bis(2-ethylhexyl) sulphoxide; 3,3'-(sulfinyldimethanediyl)diheptane |
| Molekylær Formel |
C16H34OS |
| Molekylvekt |
274.5056 |
| InChI |
InChI=1/C16H34OS/c1-5-9-11-15(7-3)13-18(17)14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3 |
| CAS-nummer |
82374-34-3 |
| Molecular Structure |
|
| Tetthet |
0.906g/cm3 |
| Kokepunkt |
390.6°C at 760 mmHg |
| Brytningsindeks |
1.472 |
| Flammepunktet |
190°C |
| Damptrykk |
5.9E-06mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
