ChemNet > CAS > 825-44-5 Thianaphthene-1,1-dioxide
825-44-5 Thianaphthene-1,1-dioxide
produktnavn |
Thianaphthene-1,1-dioxide |
Engelsk navn |
Thianaphthene-1,1-dioxide; Thianaphthene 1,1-dioxide; Benzo[b]thiophene 1,1-dioxide; 1-benzothiophene 1,1-dioxide |
Molekylær Formel |
C8H6O2S |
Molekylvekt |
166.197 |
InChI |
InChI=1/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
CAS-nummer |
825-44-5 |
EINECS |
212-544-8 |
Molecular Structure |
|
Tetthet |
1.403g/cm3 |
Smeltepunkt |
137-138℃ |
Kokepunkt |
371.1°C at 760 mmHg |
Brytningsindeks |
1.64 |
Flammepunktet |
244°C |
Damptrykk |
2.25E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|