ChemNet > CAS > 83-27-2 Diethyl sec-Butylmalonate
83-27-2 Diethyl sec-Butylmalonate
produktnavn |
Diethyl sec-Butylmalonate |
Engelsk navn |
Diethyl sec-Butylmalonate; Butylmalonicaciddiethylester; sec-Butylmalonic acid diethyl ester; diethyl butan-2-ylpropanedioate; diethyl [(1S)-1-methylpropyl]propanedioate; diethyl [(1R)-1-methylpropyl]propanedioate |
Molekylær Formel |
C11H20O4 |
Molekylvekt |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
CAS-nummer |
83-27-2 |
EINECS |
201-463-3 |
Molecular Structure |
|
Tetthet |
0.992g/cm3 |
Kokepunkt |
247.5°C at 760 mmHg |
Brytningsindeks |
1.431 |
Flammepunktet |
103.1°C |
Damptrykk |
0.0256mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|