ChemNet > CAS > 85-55-2 2-(4-Methylbenzoyl)benzoic acid
85-55-2 2-(4-Methylbenzoyl)benzoic acid
| produktnavn |
2-(4-Methylbenzoyl)benzoic acid |
| Engelsk navn |
2-(4-Methylbenzoyl)benzoic acid; 2-(p-Toluoyl)benzoic acid; 4-Methylbenzophenone-2-carboxylic acid; 2-[(4-methylphenyl)carbonyl]benzoate |
| Molekylær Formel |
C15H11O3 |
| Molekylvekt |
239.2466 |
| InChI |
InChI=1/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18)/p-1 |
| CAS-nummer |
85-55-2 |
| EINECS |
201-614-3 |
| Molecular Structure |
|
| Smeltepunkt |
137-139℃ |
| Kokepunkt |
457.1°C at 760 mmHg |
| Flammepunktet |
244.3°C |
| Damptrykk |
3.79E-09mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
