ChemNet > CAS > 86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
| produktnavn |
ethyl 2,4-dichloro-6-methylnicotinate |
| Engelsk navn |
ethyl 2,4-dichloro-6-methylnicotinate; ethyl 2,4-dichloro-6-methylpyridine-3-carboxylate; 2,4-dichloro-6-methylpyridine-3-carboxylate |
| Molekylær Formel |
C9H9Cl2NO2 |
| Molekylvekt |
234.0793 |
| InChI |
InChI=1/C9H9Cl2NO2/c1-3-14-9(13)7-6(10)4-5(2)12-8(7)11/h4H,3H2,1-2H3 |
| CAS-nummer |
86129-63-7 |
| Molecular Structure |
|
| Tetthet |
1.32g/cm3 |
| Smeltepunkt |
56℃ |
| Kokepunkt |
298.2°C at 760 mmHg |
| Brytningsindeks |
1.537 |
| Flammepunktet |
134.1°C |
| Damptrykk |
0.00129mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
