ChemNet > CAS > 868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
| produktnavn |
2-Amino-1-propene-1,1,3-tricarbonitrile |
| Engelsk navn |
2-Amino-1-propene-1,1,3-tricarbonitrile; 2-aminoprop-1-ene-1,1,3-tricarbonitrile |
| Molekylær Formel |
C6H4N4 |
| Molekylvekt |
132.1228 |
| InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
| CAS-nummer |
868-54-2 |
| EINECS |
212-777-5 |
| Molecular Structure |
|
| Tetthet |
1.13g/cm3 |
| Smeltepunkt |
171-173℃ |
| Kokepunkt |
454.9°C at 760 mmHg |
| Brytningsindeks |
1.565 |
| Flammepunktet |
228.9°C |
| Damptrykk |
1.84E-08mmHg at 25°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
