ChemNet > CAS > 87223-76-5 etyl 2-(2-cyanoanilino)acetat
87223-76-5 etyl 2-(2-cyanoanilino)acetat
| produktnavn |
etyl 2-(2-cyanoanilino)acetat |
| Synonymer |
etyl N-(2-cyanofenyl)glycinat |
| Engelsk navn |
ethyl 2-(2-cyanoanilino)acetate;ethyl N-(2-cyanophenyl)glycinate |
| Molekylær Formel |
C11H12N2O2 |
| Molekylvekt |
204.2252 |
| InChI |
InChI=1/C11H12N2O2/c1-2-15-11(14)8-13-10-6-4-3-5-9(10)7-12/h3-6,13H,2,8H2,1H3 |
| CAS-nummer |
87223-76-5 |
| Molecular Structure |
|
| Tetthet |
1.15g/cm3 |
| Kokepunkt |
351.1°C at 760 mmHg |
| Brytningsindeks |
1.538 |
| Flammepunktet |
166.1°C |
| Damptrykk |
4.2E-05mmHg at 25°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
