ChemNet > CAS > 89466-08-0 2-Hydroxybenzeneboronic acid
89466-08-0 2-Hydroxybenzeneboronic acid
produktnavn |
2-Hydroxybenzeneboronic acid |
Engelsk navn |
2-Hydroxybenzeneboronic acid; 2-Boronophenol; 2-Hydroxyphenylboronic acid |
Molekylær Formel |
C6H7BO3 |
Molekylvekt |
137.929 |
InChI |
InChI=1/C6H7BO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8-10H |
CAS-nummer |
89466-08-0 |
Molecular Structure |
|
Tetthet |
1.32g/cm3 |
Kokepunkt |
327.3°C at 760 mmHg |
Brytningsindeks |
1.582 |
Flammepunktet |
151.7°C |
Damptrykk |
8.28E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|