ChemNet > CAS > 9017-21-4 Poly (vinyltoluen), blandede isomerer
9017-21-4 Poly (vinyltoluen), blandede isomerer
produktnavn |
Poly (vinyltoluen), blandede isomerer |
Synonymer |
;p olyvinyltoluen; Vinyl toluen harpiks |
Engelsk navn |
Poly(vinyltoluene), mixed isomers; polyvinyltoluene; Vinyl toluene resin |
Molekylær Formel |
(C9H10)x |
Molekylvekt |
118.178 |
InChI |
InChI=1/C9H10/c1-3-9-7-5-4-6-8(9)2/h3-7H,1H2,2H3 |
CAS-nummer |
9017-21-4 |
Molecular Structure |
|
Kokepunkt |
100℃ |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|