ChemNet > CAS > 90259-31-7 2-Bromo-6-methylbenzoic acid
90259-31-7 2-Bromo-6-methylbenzoic acid
| produktnavn |
2-Bromo-6-methylbenzoic acid |
| Engelsk navn |
2-Bromo-6-methylbenzoic acid; 6-Bromo-o-toluic acid |
| Molekylær Formel |
C8H7BrO2 |
| Molekylvekt |
215.044 |
| InChI |
InChI=1/C8H7BrO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| CAS-nummer |
90259-31-7 |
| Molecular Structure |
|
| Tetthet |
1.6g/cm3 |
| Smeltepunkt |
108-112℃ |
| Kokepunkt |
307.043°C at 760 mmHg |
| Brytningsindeks |
1.595 |
| Flammepunktet |
139.495°C |
| Damptrykk |
0mmHg at 25°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R22:;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
