ChemNet > CAS > 90292-67-4 2-Chloro-3,6-difluorobenzyl bromide
90292-67-4 2-Chloro-3,6-difluorobenzyl bromide
produktnavn |
2-Chloro-3,6-difluorobenzyl bromide |
Engelsk navn |
2-Chloro-3,6-difluorobenzyl bromide; alpha-Bromo-2-chloro-3,6-difluorotoluene; 2-(bromomethyl)-3-chloro-1,4-difluorobenzene |
Molekylær Formel |
C7H4BrClF2 |
Molekylvekt |
241.4605 |
InChI |
InChI=1/C7H4BrClF2/c8-3-4-5(10)1-2-6(11)7(4)9/h1-2H,3H2 |
CAS-nummer |
90292-67-4 |
Molecular Structure |
|
Tetthet |
1.733g/cm3 |
Kokepunkt |
221.3°C at 760 mmHg |
Brytningsindeks |
1.541 |
Flammepunktet |
87.6°C |
Damptrykk |
0.16mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R34:Causes burns.;
R36:Irritating to eyes.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|