ChemNet > CAS > 90721-27-0 1-benzofuran-5-carboxylic acid
90721-27-0 1-benzofuran-5-carboxylic acid
produktnavn |
1-benzofuran-5-carboxylic acid |
Engelsk navn |
1-benzofuran-5-carboxylic acid; |
Molekylær Formel |
C9H6O3 |
Molekylvekt |
162.1421 |
InChI |
InChI=1/C9H6O3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11) |
CAS-nummer |
90721-27-0 |
Molecular Structure |
|
Tetthet |
1.363g/cm3 |
Smeltepunkt |
188℃ |
Kokepunkt |
325.6°C at 760 mmHg |
Brytningsindeks |
1.649 |
Flammepunktet |
150.7°C |
Damptrykk |
9.31E-05mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|