ChemNet > CAS > 91-61-2 6-Methyl-1,2,3,4-tetrahydroquinoline
91-61-2 6-Methyl-1,2,3,4-tetrahydroquinoline
produktnavn |
6-Methyl-1,2,3,4-tetrahydroquinoline |
Engelsk navn |
6-Methyl-1,2,3,4-tetrahydroquinoline;1,2,3,4-Tetrahydro-6-methylquinoline; AI3-36188; Civettal; NSC 65606; p-Methyltetrahydroquinoline; Quinoline, 1,2,3,4-tetrahydro-6-methyl- |
Molekylær Formel |
C10H13N |
Molekylvekt |
147.2169 |
InChI |
InChI=1/C10H13N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h4-5,7,11H,2-3,6H2,1H3 |
CAS-nummer |
91-61-2 |
EINECS |
202-083-0 |
Molecular Structure |
|
Tetthet |
0.99g/cm3 |
Kokepunkt |
264.2°C at 760 mmHg |
Brytningsindeks |
1.539 |
Flammepunktet |
119.1°C |
Damptrykk |
0.00982mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|