922-55-4 Lanthionine
produktnavn |
Lanthionine |
Engelsk navn |
Lanthionine; lanthionine, mixture of dl and meso; di(2-amino-2-carboxyethyl) sulphide; S-[(2R)-2-amino-2-carboxyethyl]-D-cysteine; S-[(2R)-2-amino-2-carboxyethyl]-L-cysteine; (2S,2'S)-3,3'-sulfanediylbis(2-ammoniopropanoate) |
Molekylær Formel |
C6H12N2O4S |
Molekylvekt |
208.2355 |
InChI |
InChI=1/C6H12N2O4S/c7-3(5(9)10)1-13-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1 |
CAS-nummer |
922-55-4 |
EINECS |
213-076-7 |
Molecular Structure |
|
Tetthet |
1.499g/cm3 |
Smeltepunkt |
280-283℃ |
Kokepunkt |
462.6°C at 760 mmHg |
Brytningsindeks |
1.606 |
Flammepunktet |
233.5°C |
Damptrykk |
7.72E-10mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|