ChemNet > CAS > 93041-45-3 3-(4-metoksyfenyl)-5-metyl-4-isoksazolkarboksylsyre
93041-45-3 3-(4-metoksyfenyl)-5-metyl-4-isoksazolkarboksylsyre
| produktnavn |
3-(4-metoksyfenyl)-5-metyl-4-isoksazolkarboksylsyre |
| Synonymer |
3-(4-metoksyfenyl)-5-metylisoksazol-4-karboksylsyre |
| Engelsk navn |
3-(4-methoxyphenyl)-5-methyl-4-isoxazolecarboxylic acid;3-(4-methoxyphenyl)-5-methylisoxazole-4-carboxylic acid |
| Molekylær Formel |
C12H11NO4 |
| Molekylvekt |
233.22 |
| InChI |
InChI=1/C12H11NO4/c1-7-10(12(14)15)11(13-17-7)8-3-5-9(16-2)6-4-8/h3-6H,1-2H3,(H,14,15) |
| CAS-nummer |
93041-45-3 |
| Molecular Structure |
|
| Tetthet |
1.27g/cm3 |
| Smeltepunkt |
191℃ |
| Kokepunkt |
399.1°C at 760 mmHg |
| Brytningsindeks |
1.563 |
| Flammepunktet |
195.2°C |
| Damptrykk |
4.37E-07mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
