ChemNet > CAS > 931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
produktnavn |
1,2-Cyclohexanediol, mixture of cis and trans |
Engelsk navn |
1,2-Cyclohexanediol, mixture of cis and trans; 1,2-Cyclohexanediol, cis/trans-mix; 1,2-Cyclohexanediol; 1,2-Cyclohexandiol |
Molekylær Formel |
C6H12O2 |
Molekylvekt |
116.16 |
InChI |
InChI=1/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 |
CAS-nummer |
931-17-9 |
EINECS |
213-229-8 |
Molecular Structure |
|
Smeltepunkt |
73-77℃ |
Kokepunkt |
118-120℃ (10 mmHg) |
Vannløselighet |
soluble |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S23:;
S24/25:;
|
|