934-00-9 3-Methoxycatechol
produktnavn |
3-Methoxycatechol |
Engelsk navn |
3-Methoxycatechol; Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
Molekylær Formel |
C7H8O3 |
Molekylvekt |
140.1366 |
InChI |
InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
CAS-nummer |
934-00-9 |
EINECS |
213-276-4 |
Molecular Structure |
|
Tetthet |
1.27g/cm3 |
Smeltepunkt |
39-43℃ |
Kokepunkt |
268.1°C at 760 mmHg |
Brytningsindeks |
1.579 |
Flammepunktet |
119.5°C |
Damptrykk |
0.00476mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|