ChemNet > CAS > 937-00-8 3-(trifluoromethyl)thiophenol
937-00-8 3-(trifluoromethyl)thiophenol
| produktnavn |
3-(trifluoromethyl)thiophenol |
| Engelsk navn |
3-(trifluoromethyl)thiophenol; 3-(Trifluoromethyl)benzenethiol; 1-bromo-5-chloro-2-fluoro-4-methylbenzene; 3-Trifluoromethyl thiophenol |
| Molekylær Formel |
C7H5BrClF |
| Molekylvekt |
223.47 |
| InChI |
InChI=1/C7H5BrClF/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3 |
| CAS-nummer |
937-00-8 |
| Molecular Structure |
|
| Tetthet |
1.618g/cm3 |
| Kokepunkt |
221.1°C at 760 mmHg |
| Brytningsindeks |
1.545 |
| Flammepunktet |
87.5°C |
| Damptrykk |
0.162mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
