ChemNet > CAS > 937-64-4 4-chlorophenyl chlorothionoformate
937-64-4 4-chlorophenyl chlorothionoformate
| produktnavn |
4-chlorophenyl chlorothionoformate |
| Engelsk navn |
4-chlorophenyl chlorothionoformate; O-(4-Chlorophenyl chlorothioformate); O-(4-chlorophenyl) carbonochloridothioate; 4-chlorophenyl chlorothioformate |
| Molekylær Formel |
C7H4Cl2OS |
| Molekylvekt |
207.0771 |
| InChI |
InChI=1/C7H4Cl2OS/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H |
| CAS-nummer |
937-64-4 |
| EINECS |
213-334-9 |
| Molecular Structure |
|
| Tetthet |
1.46g/cm3 |
| Kokepunkt |
251.7°C at 760 mmHg |
| Brytningsindeks |
1.622 |
| Flammepunktet |
106°C |
| Damptrykk |
0.0321mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
