ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
| produktnavn |
2-Methyl-5-nitrobenzonitrile |
| Engelsk navn |
2-Methyl-5-nitrobenzonitrile; 5-Nitro-o-tolunitrile |
| Molekylær Formel |
C8H6N2O2 |
| Molekylvekt |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
| CAS-nummer |
939-83-3 |
| Molecular Structure |
|
| Tetthet |
1.26g/cm3 |
| Smeltepunkt |
103.5-107.5℃ |
| Kokepunkt |
291.5°C at 760 mmHg |
| Brytningsindeks |
1.568 |
| Flammepunktet |
130.1°C |
| Damptrykk |
0.00194mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
