94-46-2 isopentyl benzoate
produktnavn |
isopentyl benzoate |
Engelsk navn |
isopentyl benzoate; Benzoic acid isoamyl ester; 3-methyl-1-butanol benzoate; benzoic acid isopentyl ester; Isoamyl Benzoate; 3-methylbutyl benzoate |
Molekylær Formel |
C12H16O2 |
Molekylvekt |
192.2542 |
InChI |
InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
CAS-nummer |
94-46-2 |
EINECS |
202-334-4 |
Molecular Structure |
|
Tetthet |
0.992g/cm3 |
Kokepunkt |
260°C at 760 mmHg |
Brytningsindeks |
1.495 |
Flammepunktet |
109.4°C |
Damptrykk |
0.0125mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|