ChemNet > CAS > 944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
| produktnavn |
4-amino-2,3,5,6-tetrafluorobenzoic acid |
| Engelsk navn |
4-amino-2,3,5,6-tetrafluorobenzoic acid; |
| Molekylær Formel |
C7H3F4NO2 |
| Molekylvekt |
209.0978 |
| InChI |
InChI=1/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14) |
| CAS-nummer |
944-43-4 |
| EINECS |
213-409-6 |
| Molecular Structure |
|
| Tetthet |
1.726g/cm3 |
| Smeltepunkt |
185-187℃ |
| Kokepunkt |
283.6°C at 760 mmHg |
| Brytningsindeks |
1.529 |
| Flammepunktet |
125.3°C |
| Damptrykk |
0.00148mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
