ChemNet > CAS > 952-97-6 4-Nitrophenyl phenyl sulfide
952-97-6 4-Nitrophenyl phenyl sulfide
produktnavn |
4-Nitrophenyl phenyl sulfide |
Engelsk navn |
4-Nitrophenyl phenyl sulfide; 4-Nitrodiphenyl Sulfide; 1-nitro-4-(phenylsulfanyl)benzene |
Molekylær Formel |
C12H9NO2S |
Molekylvekt |
231.2704 |
InChI |
InChI=1/C12H9NO2S/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9H |
CAS-nummer |
952-97-6 |
EINECS |
213-462-5 |
Molecular Structure |
|
Tetthet |
1.31g/cm3 |
Smeltepunkt |
54-58℃ |
Kokepunkt |
396.8°C at 760 mmHg |
Brytningsindeks |
1.665 |
Flammepunktet |
193.8°C |
Damptrykk |
3.8E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|