973-67-1 5,6,7-Trimethoxyflavone
produktnavn |
5,6,7-Trimethoxyflavone |
Engelsk navn |
5,6,7-Trimethoxyflavone; Baicalein trimethyl ether; 5,6,7-trimethoxy-2-phenyl-4H-chromen-4-one |
Molekylær Formel |
C18H16O5 |
Molekylvekt |
312.3166 |
InChI |
InChI=1/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3 |
CAS-nummer |
973-67-1 |
Molecular Structure |
|
Tetthet |
1.242g/cm3 |
Smeltepunkt |
165-167℃ |
Kokepunkt |
497.4°C at 760 mmHg |
Brytningsindeks |
1.585 |
Flammepunktet |
221.3°C |
Damptrykk |
4.97E-10mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|