ChemNet > CAS > 98041-44-2 2-Iodophenyl isothiocyanate
98041-44-2 2-Iodophenyl isothiocyanate
| produktnavn |
2-Iodophenyl isothiocyanate |
| Engelsk navn |
2-Iodophenyl isothiocyanate; 2-Iodoisothiocyanatobenzene; 1-iodo-2-isothiocyanatobenzene |
| Molekylær Formel |
C7H4INS |
| Molekylvekt |
261.0828 |
| InChI |
InChI=1/C7H4INS/c8-6-3-1-2-4-7(6)9-5-10/h1-4H |
| CAS-nummer |
98041-44-2 |
| Molecular Structure |
|
| Tetthet |
1.76g/cm3 |
| Smeltepunkt |
36-39℃ |
| Kokepunkt |
304.2°C at 760 mmHg |
| Brytningsindeks |
1.672 |
| Flammepunktet |
137.8°C |
| Damptrykk |
0.0016mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
